| Name | 4-isopropoxybenzoic acid |
| Synonyms | NSC 16646 AKOS BB-8630 ASISCHEM T31128 RARECHEM AL BE 0294 4-isopropxybenzoic acid 4-isopropoxybenzoic acid P-ISO-PROPOXYBENZOIC ACID 4-(1-methylethoxy)benzoate 4-(Isopropyloxy)benzoicacid 4-(2-Propyloxy)benzoic acid 4-ISO-PROPYLOXYBENZOIC ACID 4-(Prop-2-yloxy)benzoic acid 4-(1-METHYLETHOXY)BENZOIC ACID 4-(propan-2-yloxy)benzoic acid Benzoic acid, 4-(1-methylethoxy)- 4-ISOPROPOXYBENZOIC ACID FOR SYNTHESIS |
| CAS | 13205-46-4 |
| EINECS | 236-169-4 |
| InChI | InChI=1/C10H12O3/c1-7(2)13-9-5-3-8(4-6-9)10(11)12/h3-7H,1-2H3,(H,11,12)/p-1 |
| Molecular Formula | C10H12O3 |
| Molar Mass | 180.2 |
| Density | 1.130 |
| Melting Point | 164-167 °C (lit.) |
| Boling Point | 297℃ |
| Flash Point | 116℃ |
| Water Solubility | Insoluble in water. |
| Vapor Presure | 0.00061mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| pKa | pK1:4.68 (20°C) |
| Storage Condition | Store below +30°C. |
| Refractive Index | 1.5160 (estimate) |
| MDL | MFCD00044318 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Hazard Class | IRRITANT |